C24H28N2O5S — CID 47087994
[4-[3-(cyclopropylcarbamoyl)piperidine-1-carbonyl]phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 47087994) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is [4-[3-(cyclopropylcarbamoyl)piperidine-1-carbonyl]phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [4-[3-(cyclopropylcarbamoyl)piperidine-1-carbonyl]phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 47087994 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [4-[3-(cyclopropylcarbamoyl)piperidine-1-carbonyl]phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccc(C(=O)N3CCCC(C(=O)NC4CC4)C3)cc2)c1 |
| InChI | InChI=1S/C24H28N2O5S/c1-16-5-6-17(2)22(14-16)32(29,30)31-21-11-7-18(8-12-21)24(28)26-13-3-4-19(15-26)23(27)25-20-9-10-20/h5-8,11-12,14,19-20H,3-4,9-10,13,15H2,1-2H3,(H,25,27) |
| InChIKey | FYGQVNKFEBEPNY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|