C24H24N2O5S — CID 55784939
[4-[(3-acetamido-4-methylphenyl)carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 55784939) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is [4-[(3-acetamido-4-methylphenyl)carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [4-[(3-acetamido-4-methylphenyl)carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 55784939 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [4-[(3-acetamido-4-methylphenyl)carbamoyl]phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | CC(=O)Nc1cc(NC(=O)c2ccc(OS(=O)(=O)c3cc(C)ccc3C)cc2)ccc1C |
| InChI | InChI=1S/C24H24N2O5S/c1-15-5-6-17(3)23(13-15)32(29,30)31-21-11-8-19(9-12-21)24(28)26-20-10-7-16(2)22(14-20)25-18(4)27/h5-14H,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | SIMYYTWVPQWLSN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|