C15H14N4O7S — CID 55704286
N-methoxy-4-[[(3-nitrobenzoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 55704286) has the molecular formula C15H14N4O7S and a molecular weight of 394.37 g/mol. Its IUPAC name is N-methoxy-4-[[(3-nitrobenzoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-methoxy-4-[[(3-nitrobenzoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55704286 |
| Molecular Formula | C15H14N4O7S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | N-methoxy-4-[[(3-nitrobenzoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CONS(=O)(=O)c1ccc(C(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C15H14N4O7S/c1-26-18-27(24,25)13-7-5-10(6-8-13)14(20)16-17-15(21)11-3-2-4-12(9-11)19(22)23/h2-9,18H,1H3,(H,16,20)(H,17,21) |
| InChIKey | IUKLNEMCDDMHQB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|