C16H16N4O7S — CID 35125317
N-methoxy-N-methyl-3-[[(3-nitrobenzoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 35125317) has the molecular formula C16H16N4O7S and a molecular weight of 408.39 g/mol. Its IUPAC name is N-methoxy-N-methyl-3-[[(3-nitrobenzoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-methoxy-N-methyl-3-[[(3-nitrobenzoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35125317 |
| Molecular Formula | C16H16N4O7S |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-methoxy-N-methyl-3-[[(3-nitrobenzoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1cccc(C(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C16H16N4O7S/c1-19(27-2)28(25,26)14-8-4-6-12(10-14)16(22)18-17-15(21)11-5-3-7-13(9-11)20(23)24/h3-10H,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | NXJSZDXVZVSVGM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|