C18H21ClN4O5S — CID 87874224
[3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate (PubChem CID 87874224) has the molecular formula C18H21ClN4O5S and a molecular weight of 440.91 g/mol. Its IUPAC name is [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate.
| Compound Name | [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 87874224 |
| Molecular Formula | C18H21ClN4O5S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | [3-[(3Z)-3-(diaminomethylidenehydrazinylidene)propoxy]-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)Oc1cc(C)cc(OCC/C=N\N=C(N)N)c1 |
| InChI | InChI=1S/C18H21ClN4O5S/c1-12-8-14(27-7-3-6-22-23-18(20)21)11-15(9-12)28-29(24,25)17-10-13(19)4-5-16(17)26-2/h4-6,8-11H,3,7H2,1-2H3,(H4,20,21,23)/b22-6- |
| InChIKey | OSRMFGYUTOICPO-HCDFXORVSA-N |
| XLogP | 2.45 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|