C17H20ClNO6S — CID 22722441
[3-(3-aminooxypropoxy)-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate (PubChem CID 22722441) has the molecular formula C17H20ClNO6S and a molecular weight of 401.87 g/mol. Its IUPAC name is [3-(3-aminooxypropoxy)-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate.
| Compound Name | [3-(3-aminooxypropoxy)-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 22722441 |
| Molecular Formula | C17H20ClNO6S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | [3-(3-aminooxypropoxy)-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)Oc1cc(C)cc(OCCCON)c1 |
| InChI | InChI=1S/C17H20ClNO6S/c1-12-8-14(23-6-3-7-24-19)11-15(9-12)25-26(20,21)17-10-13(18)4-5-16(17)22-2/h4-5,8-11H,3,6-7,19H2,1-2H3 |
| InChIKey | GOXXOLMVJZEPLS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|