C27H29ClN2O6S — CID 86584804
[3-[2-[4-amino-2-[(2-methylpropan-2-yl)oxycarbonyliminomethyl]phenyl]ethoxy]-5-methylphenyl] 2-chlorobenzenesulfonate (PubChem CID 86584804) has the molecular formula C27H29ClN2O6S and a molecular weight of 545.06 g/mol. Its IUPAC name is [3-[2-[4-amino-2-[(2-methylpropan-2-yl)oxycarbonyliminomethyl]phenyl]ethoxy]-5-methylphenyl] 2-chlorobenzenesulfonate.
| Compound Name | [3-[2-[4-amino-2-[(2-methylpropan-2-yl)oxycarbonyliminomethyl]phenyl]ethoxy]-5-methylphenyl] 2-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 86584804 |
| Molecular Formula | C27H29ClN2O6S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | [3-[2-[4-amino-2-[(2-methylpropan-2-yl)oxycarbonyliminomethyl]phenyl]ethoxy]-5-methylphenyl] 2-chlorobenzenesulfonate |
| SMILES | Cc1cc(OCCc2ccc(N)cc2C=NC(=O)OC(C)(C)C)cc(OS(=O)(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C27H29ClN2O6S/c1-18-13-22(16-23(14-18)36-37(32,33)25-8-6-5-7-24(25)28)34-12-11-19-9-10-21(29)15-20(19)17-30-26(31)35-27(2,3)4/h5-10,13-17H,11-12,29H2,1-4H3 |
| InChIKey | BNZQLXQDMJBKJJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|