C27H31ClN2O6S — CID 91485481
3-[3-[2-[4-amino-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethoxy]-5-methylphenyl]-2-chlorobenzenesulfonic acid (PubChem CID 91485481) has the molecular formula C27H31ClN2O6S and a molecular weight of 547.07 g/mol. Its IUPAC name is 3-[3-[2-[4-amino-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethoxy]-5-methylphenyl]-2-chlorobenzenesulfonic acid.
| Compound Name | 3-[3-[2-[4-amino-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethoxy]-5-methylphenyl]-2-chlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 91485481 |
| Molecular Formula | C27H31ClN2O6S |
| Molecular Weight | 547.07 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 3-[3-[2-[4-amino-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]ethoxy]-5-methylphenyl]-2-chlorobenzenesulfonic acid |
| SMILES | Cc1cc(OCCc2ccc(N)c(NC(=O)OC(C)(C)C)c2C)cc(-c2cccc(S(=O)(=O)O)c2Cl)c1 |
| InChI | InChI=1S/C27H31ClN2O6S/c1-16-13-19(21-7-6-8-23(24(21)28)37(32,33)34)15-20(14-16)35-12-11-18-9-10-22(29)25(17(18)2)30-26(31)36-27(3,4)5/h6-10,13-15H,11-12,29H2,1-5H3,(H,30,31)(H,32,33,34) |
| InChIKey | LUWAEJXNZIWZBV-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.07 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|