C25H26ClNO5S — CID 90711762
2-chloro-3-[3-[2-[4-(ethoxyiminomethyl)phenyl]ethoxy]-5-ethylphenyl]benzenesulfonic acid (PubChem CID 90711762) has the molecular formula C25H26ClNO5S and a molecular weight of 488.01 g/mol. Its IUPAC name is 2-chloro-3-[3-[2-[4-(ethoxyiminomethyl)phenyl]ethoxy]-5-ethylphenyl]benzenesulfonic acid.
| Compound Name | 2-chloro-3-[3-[2-[4-(ethoxyiminomethyl)phenyl]ethoxy]-5-ethylphenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90711762 |
| Molecular Formula | C25H26ClNO5S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-chloro-3-[3-[2-[4-(ethoxyiminomethyl)phenyl]ethoxy]-5-ethylphenyl]benzenesulfonic acid |
| SMILES | CCON=Cc1ccc(CCOc2cc(CC)cc(-c3cccc(S(=O)(=O)O)c3Cl)c2)cc1 |
| InChI | InChI=1S/C25H26ClNO5S/c1-3-18-14-21(23-6-5-7-24(25(23)26)33(28,29)30)16-22(15-18)31-13-12-19-8-10-20(11-9-19)17-27-32-4-2/h5-11,14-17H,3-4,12-13H2,1-2H3,(H,28,29,30) |
| InChIKey | JICSAYFAOCDJKW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|