C15H12F3NO — CID 142418631
1-[4-(3,5-difluorophenyl)-3-fluorophenyl]-N-ethoxymethanimine (PubChem CID 142418631) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is 1-[4-(3,5-difluorophenyl)-3-fluorophenyl]-N-ethoxymethanimine.
| Compound Name | 1-[4-(3,5-difluorophenyl)-3-fluorophenyl]-N-ethoxymethanimine |
|---|---|
| PubChem CID | 142418631 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 1-[4-(3,5-difluorophenyl)-3-fluorophenyl]-N-ethoxymethanimine |
| SMILES | CCON=Cc1ccc(-c2cc(F)cc(F)c2)c(F)c1 |
| InChI | InChI=1S/C15H12F3NO/c1-2-20-19-9-10-3-4-14(15(18)5-10)11-6-12(16)8-13(17)7-11/h3-9H,2H2,1H3 |
| InChIKey | WIZSJLUDBIDIDB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|