C24H24ClNO6S — CID 91269506
[3-[2-[3-(ethoxyiminomethyl)phenyl]ethoxy]-5-methoxyphenyl] 2-chlorobenzenesulfonate (PubChem CID 91269506) has the molecular formula C24H24ClNO6S and a molecular weight of 489.98 g/mol. Its IUPAC name is [3-[2-[3-(ethoxyiminomethyl)phenyl]ethoxy]-5-methoxyphenyl] 2-chlorobenzenesulfonate.
| Compound Name | [3-[2-[3-(ethoxyiminomethyl)phenyl]ethoxy]-5-methoxyphenyl] 2-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 91269506 |
| Molecular Formula | C24H24ClNO6S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | [3-[2-[3-(ethoxyiminomethyl)phenyl]ethoxy]-5-methoxyphenyl] 2-chlorobenzenesulfonate |
| SMILES | CCON=Cc1cccc(CCOc2cc(OC)cc(OS(=O)(=O)c3ccccc3Cl)c2)c1 |
| InChI | InChI=1S/C24H24ClNO6S/c1-3-31-26-17-19-8-6-7-18(13-19)11-12-30-21-14-20(29-2)15-22(16-21)32-33(27,28)24-10-5-4-9-23(24)25/h4-10,13-17H,3,11-12H2,1-2H3 |
| InChIKey | BOQRUGGDUGJMIF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|