C26H28ClN2O6S+ — CID 54045914
carboxymethyl-(2-chlorophenyl)sulfonyl-[3-[2-[4-(ethoxyiminomethyl)phenyl]ethoxy]phenyl]-methylazanium (PubChem CID 54045914) has the molecular formula C26H28ClN2O6S+ and a molecular weight of 532.04 g/mol. Its IUPAC name is carboxymethyl-(2-chlorophenyl)sulfonyl-[3-[2-[4-(ethoxyiminomethyl)phenyl]ethoxy]phenyl]-methylazanium.
| Compound Name | carboxymethyl-(2-chlorophenyl)sulfonyl-[3-[2-[4-(ethoxyiminomethyl)phenyl]ethoxy]phenyl]-methylazanium |
|---|---|
| PubChem CID | 54045914 |
| Molecular Formula | C26H28ClN2O6S+ |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | carboxymethyl-(2-chlorophenyl)sulfonyl-[3-[2-[4-(ethoxyiminomethyl)phenyl]ethoxy]phenyl]-methylazanium |
| SMILES | CCON=Cc1ccc(CCOc2cccc([N+](C)(CC(=O)O)S(=O)(=O)c3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C26H27ClN2O6S/c1-3-35-28-18-21-13-11-20(12-14-21)15-16-34-23-8-6-7-22(17-23)29(2,19-26(30)31)36(32,33)25-10-5-4-9-24(25)27/h4-14,17-18H,3,15-16,19H2,1-2H3/p+1 |
| InChIKey | VJDZJXYGOQIQJI-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|