C22H20F3N3O4S — CID 87903048
N-[3-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]phenyl]-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 87903048) has the molecular formula C22H20F3N3O4S and a molecular weight of 479.48 g/mol. Its IUPAC name is N-[3-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]phenyl]-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 87903048 |
| Molecular Formula | C22H20F3N3O4S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[3-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | N/N=C\c1ccc(CCOc2cccc(NS(=O)(=O)c3ccccc3OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H20F3N3O4S/c23-22(24,25)32-20-6-1-2-7-21(20)33(29,30)28-18-4-3-5-19(14-18)31-13-12-16-8-10-17(11-9-16)15-27-26/h1-11,14-15,28H,12-13,26H2/b27-15- |
| InChIKey | CVCARYSTFHWYIA-DICXZTSXSA-N |
| XLogP | 4.30 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|