C22H23N3O3S — CID 87903022
N-[5-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]-2-methylphenyl]benzenesulfonamide (PubChem CID 87903022) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[5-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]-2-methylphenyl]benzenesulfonamide.
| Compound Name | N-[5-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]-2-methylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87903022 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[5-[2-[4-[(Z)-hydrazinylidenemethyl]phenyl]ethoxy]-2-methylphenyl]benzenesulfonamide |
| SMILES | Cc1ccc(OCCc2ccc(/C=N\N)cc2)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-17-7-12-20(28-14-13-18-8-10-19(11-9-18)16-24-23)15-22(17)25-29(26,27)21-5-3-2-4-6-21/h2-12,15-16,25H,13-14,23H2,1H3/b24-16- |
| InChIKey | HJNWVQKSKQPACN-JLPGSUDCSA-N |
| XLogP | 3.71 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|