C14H16N2O2S — CID 827506
N-(4-amino-2,5-dimethylphenyl)benzenesulfonamide (PubChem CID 827506) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-(4-amino-2,5-dimethylphenyl)benzenesulfonamide.
| Compound Name | N-(4-amino-2,5-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 827506 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-(4-amino-2,5-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccccc2)c(C)cc1N |
| InChI | InChI=1S/C14H16N2O2S/c1-10-9-14(11(2)8-13(10)15)16-19(17,18)12-6-4-3-5-7-12/h3-9,16H,15H2,1-2H3 |
| InChIKey | WFGZARUIRVUNDZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|