C15H15N3O2S — CID 104757197
N-(5-amino-2,4-dimethylphenyl)-4-cyanobenzenesulfonamide (PubChem CID 104757197) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-(5-amino-2,4-dimethylphenyl)-4-cyanobenzenesulfonamide.
| Compound Name | N-(5-amino-2,4-dimethylphenyl)-4-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 104757197 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-(5-amino-2,4-dimethylphenyl)-4-cyanobenzenesulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccc(C#N)cc2)cc1N |
| InChI | InChI=1S/C15H15N3O2S/c1-10-7-11(2)15(8-14(10)17)18-21(19,20)13-5-3-12(9-16)4-6-13/h3-8,18H,17H2,1-2H3 |
| InChIKey | FRCNWYFJESDTQO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|