C13H9F2N3O2S — CID 81305247
N-(2-amino-4,6-difluorophenyl)-4-cyanobenzenesulfonamide (PubChem CID 81305247) has the molecular formula C13H9F2N3O2S and a molecular weight of 309.30 g/mol. Its IUPAC name is N-(2-amino-4,6-difluorophenyl)-4-cyanobenzenesulfonamide.
| Compound Name | N-(2-amino-4,6-difluorophenyl)-4-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 81305247 |
| Molecular Formula | C13H9F2N3O2S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | N-(2-amino-4,6-difluorophenyl)-4-cyanobenzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2c(N)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C13H9F2N3O2S/c14-9-5-11(15)13(12(17)6-9)18-21(19,20)10-3-1-8(7-16)2-4-10/h1-6,18H,17H2 |
| InChIKey | JPJCDRSREZBCQJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|