C10H8F2N2O2S2 — CID 81314553
N-(2-amino-4,6-difluorophenyl)thiophene-2-sulfonamide (PubChem CID 81314553) has the molecular formula C10H8F2N2O2S2 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(2-amino-4,6-difluorophenyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-amino-4,6-difluorophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 81314553 |
| Molecular Formula | C10H8F2N2O2S2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | N-(2-amino-4,6-difluorophenyl)thiophene-2-sulfonamide |
| SMILES | Nc1cc(F)cc(F)c1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C10H8F2N2O2S2/c11-6-4-7(12)10(8(13)5-6)14-18(15,16)9-2-1-3-17-9/h1-5,14H,13H2 |
| InChIKey | VSNGKQBFOBRSRS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|