C8H13N3O2S — CID 103144711
1-amino-2,5-dimethyl-4-(sulfamoylamino)benzene (PubChem CID 103144711) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 1-amino-2,5-dimethyl-4-(sulfamoylamino)benzene.
| Compound Name | 1-amino-2,5-dimethyl-4-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 103144711 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-amino-2,5-dimethyl-4-(sulfamoylamino)benzene |
| SMILES | Cc1cc(NS(N)(=O)=O)c(C)cc1N |
| InChI | InChI=1S/C8H13N3O2S/c1-5-4-8(11-14(10,12)13)6(2)3-7(5)9/h3-4,11H,9H2,1-2H3,(H2,10,12,13) |
| InChIKey | HYOIHESDUXJKII-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|