C14H24N2O2S — CID 103520904
N-(4-amino-2,5-dimethylphenyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103520904) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is N-(4-amino-2,5-dimethylphenyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(4-amino-2,5-dimethylphenyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103520904 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-(4-amino-2,5-dimethylphenyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)CCC(C)(C)C)c(C)cc1N |
| InChI | InChI=1S/C14H24N2O2S/c1-10-9-13(11(2)8-12(10)15)16-19(17,18)7-6-14(3,4)5/h8-9,16H,6-7,15H2,1-5H3 |
| InChIKey | RPBISLGPWKQHLI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|