C8H12N2O3S — CID 106954609
1-hydroxy-2,5-dimethyl-4-(sulfamoylamino)benzene (PubChem CID 106954609) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-hydroxy-2,5-dimethyl-4-(sulfamoylamino)benzene.
| Compound Name | 1-hydroxy-2,5-dimethyl-4-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 106954609 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-hydroxy-2,5-dimethyl-4-(sulfamoylamino)benzene |
| SMILES | Cc1cc(NS(N)(=O)=O)c(C)cc1O |
| InChI | InChI=1S/C8H12N2O3S/c1-5-4-8(11)6(2)3-7(5)10-14(9,12)13/h3-4,10-11H,1-2H3,(H2,9,12,13) |
| InChIKey | SWUOUYFDOODBJY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|