About 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide
5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide (PubChem CID 106831901) has the molecular formula C13H14BrNO3S2
and a molecular weight of 376.30 g/mol. Its IUPAC name is 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide |
| PubChem CID | 106831901 |
| Molecular Formula | C13H14BrNO3S2 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(C)c(Br)s2)c(C)cc1O |
| InChI | InChI=1S/C13H14BrNO3S2/c1-7-5-11(16)8(2)4-10(7)15-20(17,18)12-6-9(3)13(14)19-12/h4-6,15-16H,1-3H3 |
| InChIKey | UFOMLYGGYBAKBL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide?
The IUPAC name of 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide (CID 106831901) is 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide.
What is the SMILES notation for 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide?
The canonical SMILES for 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide is Cc1cc(NS(=O)(=O)c2cc(C)c(Br)s2)c(C)cc1O.
What is the InChIKey of 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide?
The InChIKey is UFOMLYGGYBAKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO3S2/c1-7-5-11(16)8(2)4-10(7)15-20(17,18)12-6-9(3)13(14)19-12/h4-6,15-16H,1-3H3.
What are the key properties of 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide?
5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide has a molecular weight of 376.30 g/mol, XLogP of 3.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-4-methylthiophene-2-sulfonamide is sourced from PubChem (CID 106831901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).