C13H14BrNO3S2 — CID 106831927
5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-2-methylthiophene-3-sulfonamide (PubChem CID 106831927) has the molecular formula C13H14BrNO3S2 and a molecular weight of 376.30 g/mol. Its IUPAC name is 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106831927 |
| Molecular Formula | C13H14BrNO3S2 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 5-bromo-N-(4-hydroxy-2,5-dimethylphenyl)-2-methylthiophene-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Br)sc2C)c(C)cc1O |
| InChI | InChI=1S/C13H14BrNO3S2/c1-7-5-11(16)8(2)4-10(7)15-20(17,18)12-6-13(14)19-9(12)3/h4-6,15-16H,1-3H3 |
| InChIKey | OWYMTXBDHILEAV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|