C16H19NO3S — CID 106831940
N-(4-hydroxy-2,5-dimethylphenyl)-2,5-dimethylbenzenesulfonamide (PubChem CID 106831940) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-(4-hydroxy-2,5-dimethylphenyl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(4-hydroxy-2,5-dimethylphenyl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106831940 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-(4-hydroxy-2,5-dimethylphenyl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2cc(C)c(O)cc2C)c1 |
| InChI | InChI=1S/C16H19NO3S/c1-10-5-6-11(2)16(7-10)21(19,20)17-14-8-13(4)15(18)9-12(14)3/h5-9,17-18H,1-4H3 |
| InChIKey | OLOYZDPXEOKTPI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|