C12H10BrNO5S2 — CID 104833131
3-[(5-bromo-2-methylthiophen-3-yl)sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 104833131) has the molecular formula C12H10BrNO5S2 and a molecular weight of 392.25 g/mol. Its IUPAC name is 3-[(5-bromo-2-methylthiophen-3-yl)sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 3-[(5-bromo-2-methylthiophen-3-yl)sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 104833131 |
| Molecular Formula | C12H10BrNO5S2 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | 3-[(5-bromo-2-methylthiophen-3-yl)sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C12H10BrNO5S2/c1-6-9(5-10(13)20-6)21(18,19)14-8-4-2-3-7(11(8)15)12(16)17/h2-5,14-15H,1H3,(H,16,17) |
| InChIKey | LGFGQAZKZNRPQN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|