C11H6Br2INO4S2 — CID 63408848
2-[(2,5-dibromothiophen-3-yl)sulfonylamino]-5-iodobenzoic acid (PubChem CID 63408848) has the molecular formula C11H6Br2INO4S2 and a molecular weight of 567.02 g/mol. Its IUPAC name is 2-[(2,5-dibromothiophen-3-yl)sulfonylamino]-5-iodobenzoic acid.
| Compound Name | 2-[(2,5-dibromothiophen-3-yl)sulfonylamino]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 63408848 |
| Molecular Formula | C11H6Br2INO4S2 |
| Molecular Weight | 567.02 g/mol |
| Exact Mass | 564.71 |
| IUPAC Name | 2-[(2,5-dibromothiophen-3-yl)sulfonylamino]-5-iodobenzoic acid |
| SMILES | O=C(O)c1cc(I)ccc1NS(=O)(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H6Br2INO4S2/c12-9-4-8(10(13)20-9)21(18,19)15-7-2-1-5(14)3-6(7)11(16)17/h1-4,15H,(H,16,17) |
| InChIKey | ZIULERZZABVIDD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.02 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|