C11H9IN2O4S2 — CID 104933209
5-iodo-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid (PubChem CID 104933209) has the molecular formula C11H9IN2O4S2 and a molecular weight of 424.24 g/mol. Its IUPAC name is 5-iodo-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid.
| Compound Name | 5-iodo-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 104933209 |
| Molecular Formula | C11H9IN2O4S2 |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 423.90 |
| IUPAC Name | 5-iodo-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid |
| SMILES | Cc1ncc(S(=O)(=O)Nc2ccc(I)cc2C(=O)O)s1 |
| InChI | InChI=1S/C11H9IN2O4S2/c1-6-13-5-10(19-6)20(17,18)14-9-3-2-7(12)4-8(9)11(15)16/h2-5,14H,1H3,(H,15,16) |
| InChIKey | LIDZSJXWJWSSQN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|