C11H8Br2N2O4S2 — CID 43604385
5-amino-2-[(2,5-dibromothiophen-3-yl)sulfonylamino]benzoic acid (PubChem CID 43604385) has the molecular formula C11H8Br2N2O4S2 and a molecular weight of 456.14 g/mol. Its IUPAC name is 5-amino-2-[(2,5-dibromothiophen-3-yl)sulfonylamino]benzoic acid.
| Compound Name | 5-amino-2-[(2,5-dibromothiophen-3-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 43604385 |
| Molecular Formula | C11H8Br2N2O4S2 |
| Molecular Weight | 456.14 g/mol |
| Exact Mass | 453.83 |
| IUPAC Name | 5-amino-2-[(2,5-dibromothiophen-3-yl)sulfonylamino]benzoic acid |
| SMILES | Nc1ccc(NS(=O)(=O)c2cc(Br)sc2Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H8Br2N2O4S2/c12-9-4-8(10(13)20-9)21(18,19)15-7-2-1-5(14)3-6(7)11(16)17/h1-4,15H,14H2,(H,16,17) |
| InChIKey | IZWWFILKYBQWRB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|