C11H10Br2N2O2S2 — CID 43604086
2,5-dibromo-N-[4-(methylamino)phenyl]thiophene-3-sulfonamide (PubChem CID 43604086) has the molecular formula C11H10Br2N2O2S2 and a molecular weight of 426.16 g/mol. Its IUPAC name is 2,5-dibromo-N-[4-(methylamino)phenyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-[4-(methylamino)phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 43604086 |
| Molecular Formula | C11H10Br2N2O2S2 |
| Molecular Weight | 426.16 g/mol |
| Exact Mass | 423.86 |
| IUPAC Name | 2,5-dibromo-N-[4-(methylamino)phenyl]thiophene-3-sulfonamide |
| SMILES | CNc1ccc(NS(=O)(=O)c2cc(Br)sc2Br)cc1 |
| InChI | InChI=1S/C11H10Br2N2O2S2/c1-14-7-2-4-8(5-3-7)15-19(16,17)9-6-10(12)18-11(9)13/h2-6,14-15H,1H3 |
| InChIKey | MFMHGILKRRNEMQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.16 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |