C7H9Br2NO2S2 — CID 43212966
2,5-dibromo-N-propylthiophene-3-sulfonamide (PubChem CID 43212966) has the molecular formula C7H9Br2NO2S2 and a molecular weight of 363.10 g/mol. Its IUPAC name is 2,5-dibromo-N-propylthiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-propylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 43212966 |
| Molecular Formula | C7H9Br2NO2S2 |
| Molecular Weight | 363.10 g/mol |
| Exact Mass | 360.84 |
| IUPAC Name | 2,5-dibromo-N-propylthiophene-3-sulfonamide |
| SMILES | CCCNS(=O)(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C7H9Br2NO2S2/c1-2-3-10-14(11,12)5-4-6(8)13-7(5)9/h4,10H,2-3H2,1H3 |
| InChIKey | TYQDDRKCNBUIJJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |