C9H9Br2N3O2S2 — CID 65231462
2,5-dibromo-N-[2-(1H-imidazol-5-yl)ethyl]thiophene-3-sulfonamide (PubChem CID 65231462) has the molecular formula C9H9Br2N3O2S2 and a molecular weight of 415.13 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-(1H-imidazol-5-yl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-[2-(1H-imidazol-5-yl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 65231462 |
| Molecular Formula | C9H9Br2N3O2S2 |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.85 |
| IUPAC Name | 2,5-dibromo-N-[2-(1H-imidazol-5-yl)ethyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCc1cnc[nH]1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H9Br2N3O2S2/c10-8-3-7(9(11)17-8)18(15,16)14-2-1-6-4-12-5-13-6/h3-5,14H,1-2H2,(H,12,13) |
| InChIKey | IZPMYAKJBUAFEX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |