C11H11BrFN3O2S — CID 65231327
2-bromo-4-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 65231327) has the molecular formula C11H11BrFN3O2S and a molecular weight of 348.20 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 65231327 |
| Molecular Formula | C11H11BrFN3O2S |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 2-bromo-4-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1cnc[nH]1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H11BrFN3O2S/c12-10-5-8(13)1-2-11(10)19(17,18)16-4-3-9-6-14-7-15-9/h1-2,5-7,16H,3-4H2,(H,14,15) |
| InChIKey | GESLAJLUHLDTEO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |