C11H12ClFN4O2S — CID 103051653
3-amino-5-chloro-2-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 103051653) has the molecular formula C11H12ClFN4O2S and a molecular weight of 318.76 g/mol. Its IUPAC name is 3-amino-5-chloro-2-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-2-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103051653 |
| Molecular Formula | C11H12ClFN4O2S |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3-amino-5-chloro-2-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)NCCc2cnc[nH]2)c1F |
| InChI | InChI=1S/C11H12ClFN4O2S/c12-7-3-9(14)11(13)10(4-7)20(18,19)17-2-1-8-5-15-6-16-8/h3-6,17H,1-2,14H2,(H,15,16) |
| InChIKey | CLLKQKOQRSFQON-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|