C13H17FN4O2S — CID 107325891
3-amino-4-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]-2,6-dimethylbenzenesulfonamide (PubChem CID 107325891) has the molecular formula C13H17FN4O2S and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-amino-4-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]-2,6-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-4-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107325891 |
| Molecular Formula | C13H17FN4O2S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-amino-4-fluoro-N-[2-(1H-imidazol-5-yl)ethyl]-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C13H17FN4O2S/c1-8-5-11(14)12(15)9(2)13(8)21(19,20)18-4-3-10-6-16-7-17-10/h5-7,18H,3-4,15H2,1-2H3,(H,16,17) |
| InChIKey | PGTIYUPEWVHASQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|