C11H7BrClNO5S2 — CID 66799929
3-[(4-bromo-5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 66799929) has the molecular formula C11H7BrClNO5S2 and a molecular weight of 412.67 g/mol. Its IUPAC name is 3-[(4-bromo-5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 3-[(4-bromo-5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 66799929 |
| Molecular Formula | C11H7BrClNO5S2 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 410.86 |
| IUPAC Name | 3-[(4-bromo-5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2cc(Br)c(Cl)s2)c1O |
| InChI | InChI=1S/C11H7BrClNO5S2/c12-6-4-8(20-10(6)13)21(18,19)14-7-3-1-2-5(9(7)15)11(16)17/h1-4,14-15H,(H,16,17) |
| InChIKey | IVKMILAJYLCODN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|