C10H12N2O3S — CID 106954612
1-cyano-N-(4-hydroxy-2,5-dimethylphenyl)methanesulfonamide (PubChem CID 106954612) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 1-cyano-N-(4-hydroxy-2,5-dimethylphenyl)methanesulfonamide.
| Compound Name | 1-cyano-N-(4-hydroxy-2,5-dimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 106954612 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-cyano-N-(4-hydroxy-2,5-dimethylphenyl)methanesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)CC#N)c(C)cc1O |
| InChI | InChI=1S/C10H12N2O3S/c1-7-6-10(13)8(2)5-9(7)12-16(14,15)4-3-11/h5-6,12-13H,4H2,1-2H3 |
| InChIKey | GUJKHCXPQXTDLJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|