C11H12N2O4S — CID 63927922
2-(cyanomethylsulfonylamino)-3,5-dimethylbenzoic acid (PubChem CID 63927922) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-(cyanomethylsulfonylamino)-3,5-dimethylbenzoic acid.
| Compound Name | 2-(cyanomethylsulfonylamino)-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 63927922 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(cyanomethylsulfonylamino)-3,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(NS(=O)(=O)CC#N)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H12N2O4S/c1-7-5-8(2)10(9(6-7)11(14)15)13-18(16,17)4-3-12/h5-6,13H,4H2,1-2H3,(H,14,15) |
| InChIKey | NJHSGQFIILNRHX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |