C9H6Cl2N2O4S — CID 107049552
3,6-dichloro-2-(cyanomethylsulfonylamino)benzoic acid (PubChem CID 107049552) has the molecular formula C9H6Cl2N2O4S and a molecular weight of 309.13 g/mol. Its IUPAC name is 3,6-dichloro-2-(cyanomethylsulfonylamino)benzoic acid.
| Compound Name | 3,6-dichloro-2-(cyanomethylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 107049552 |
| Molecular Formula | C9H6Cl2N2O4S |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | 3,6-dichloro-2-(cyanomethylsulfonylamino)benzoic acid |
| SMILES | N#CCS(=O)(=O)Nc1c(Cl)ccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C9H6Cl2N2O4S/c10-5-1-2-6(11)8(7(5)9(14)15)13-18(16,17)4-3-12/h1-2,13H,4H2,(H,14,15) |
| InChIKey | TXWHHBAAHAPRSM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |