C11H5ClFN3O2 — CID 168543829
6-chloro-2-(2,2-dicyanoethenylamino)-3-fluorobenzoic acid (PubChem CID 168543829) has the molecular formula C11H5ClFN3O2 and a molecular weight of 265.63 g/mol. Its IUPAC name is 6-chloro-2-(2,2-dicyanoethenylamino)-3-fluorobenzoic acid.
| Compound Name | 6-chloro-2-(2,2-dicyanoethenylamino)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 168543829 |
| Molecular Formula | C11H5ClFN3O2 |
| Molecular Weight | 265.63 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 6-chloro-2-(2,2-dicyanoethenylamino)-3-fluorobenzoic acid |
| SMILES | N#CC(C#N)=CNc1c(F)ccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C11H5ClFN3O2/c12-7-1-2-8(13)10(9(7)11(17)18)16-5-6(3-14)4-15/h1-2,5,16H,(H,17,18) |
| InChIKey | BZBZQTQWPIREBB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.63 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|