C10H3F4N3 — CID 26485483
2-[(2,3,5,6-tetrafluoroanilino)methylidene]propanedinitrile (PubChem CID 26485483) has the molecular formula C10H3F4N3 and a molecular weight of 241.15 g/mol. Its IUPAC name is 2-[(2,3,5,6-tetrafluoroanilino)methylidene]propanedinitrile.
| Compound Name | 2-[(2,3,5,6-tetrafluoroanilino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 26485483 |
| Molecular Formula | C10H3F4N3 |
| Molecular Weight | 241.15 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 2-[(2,3,5,6-tetrafluoroanilino)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H3F4N3/c11-6-1-7(12)9(14)10(8(6)13)17-4-5(2-15)3-16/h1,4,17H |
| InChIKey | ALMFOTFTHQJPNR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|