C10H4BrF2N3O — CID 168542993
2-[(5-bromo-3,4-difluoro-2-hydroxyanilino)methylidene]propanedinitrile (PubChem CID 168542993) has the molecular formula C10H4BrF2N3O and a molecular weight of 300.06 g/mol. Its IUPAC name is 2-[(5-bromo-3,4-difluoro-2-hydroxyanilino)methylidene]propanedinitrile.
| Compound Name | 2-[(5-bromo-3,4-difluoro-2-hydroxyanilino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542993 |
| Molecular Formula | C10H4BrF2N3O |
| Molecular Weight | 300.06 g/mol |
| Exact Mass | 298.95 |
| IUPAC Name | 2-[(5-bromo-3,4-difluoro-2-hydroxyanilino)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1cc(Br)c(F)c(F)c1O |
| InChI | InChI=1S/C10H4BrF2N3O/c11-6-1-7(10(17)9(13)8(6)12)16-4-5(2-14)3-15/h1,4,16-17H |
| InChIKey | KEOSTPHLSQTSCD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.06 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|