C12H9BrFN3O2 — CID 168545345
2-[(5-bromo-3-fluoro-2,4-dimethoxyanilino)methylidene]propanedinitrile (PubChem CID 168545345) has the molecular formula C12H9BrFN3O2 and a molecular weight of 326.13 g/mol. Its IUPAC name is 2-[(5-bromo-3-fluoro-2,4-dimethoxyanilino)methylidene]propanedinitrile.
| Compound Name | 2-[(5-bromo-3-fluoro-2,4-dimethoxyanilino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168545345 |
| Molecular Formula | C12H9BrFN3O2 |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-[(5-bromo-3-fluoro-2,4-dimethoxyanilino)methylidene]propanedinitrile |
| SMILES | COc1c(Br)cc(NC=C(C#N)C#N)c(OC)c1F |
| InChI | InChI=1S/C12H9BrFN3O2/c1-18-11-8(13)3-9(12(19-2)10(11)14)17-6-7(4-15)5-16/h3,6,17H,1-2H3 |
| InChIKey | KZLLVIXPYUEYJJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|