C13H10F3N3O2 — CID 168544498
2-[[2,4-dimethoxy-5-(trifluoromethyl)anilino]methylidene]propanedinitrile (PubChem CID 168544498) has the molecular formula C13H10F3N3O2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 2-[[2,4-dimethoxy-5-(trifluoromethyl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[2,4-dimethoxy-5-(trifluoromethyl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544498 |
| Molecular Formula | C13H10F3N3O2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[[2,4-dimethoxy-5-(trifluoromethyl)anilino]methylidene]propanedinitrile |
| SMILES | COc1cc(OC)c(C(F)(F)F)cc1NC=C(C#N)C#N |
| InChI | InChI=1S/C13H10F3N3O2/c1-20-11-4-12(21-2)10(3-9(11)13(14,15)16)19-7-8(5-17)6-18/h3-4,7,19H,1-2H3 |
| InChIKey | AXUHPGIJPLWUQR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|