C13H11N3O3 — CID 117063903
methyl 4-(2,2-dicyanoethenylamino)-3-methoxybenzoate (PubChem CID 117063903) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is methyl 4-(2,2-dicyanoethenylamino)-3-methoxybenzoate.
| Compound Name | methyl 4-(2,2-dicyanoethenylamino)-3-methoxybenzoate |
|---|---|
| PubChem CID | 117063903 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | methyl 4-(2,2-dicyanoethenylamino)-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(NC=C(C#N)C#N)c(OC)c1 |
| InChI | InChI=1S/C13H11N3O3/c1-18-12-5-10(13(17)19-2)3-4-11(12)16-8-9(6-14)7-15/h3-5,8,16H,1-2H3 |
| InChIKey | BZGBNOXRDRKCLQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|