C18H20N4O2 — CID 168543173
methyl 3-(2,2-dicyanoethenylamino)-4-(4-methylpiperidin-1-yl)benzoate (PubChem CID 168543173) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl 3-(2,2-dicyanoethenylamino)-4-(4-methylpiperidin-1-yl)benzoate.
| Compound Name | methyl 3-(2,2-dicyanoethenylamino)-4-(4-methylpiperidin-1-yl)benzoate |
|---|---|
| PubChem CID | 168543173 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | methyl 3-(2,2-dicyanoethenylamino)-4-(4-methylpiperidin-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CCC(C)CC2)c(NC=C(C#N)C#N)c1 |
| InChI | InChI=1S/C18H20N4O2/c1-13-5-7-22(8-6-13)17-4-3-15(18(23)24-2)9-16(17)21-12-14(10-19)11-20/h3-4,9,12-13,21H,5-8H2,1-2H3 |
| InChIKey | PITIEHGCWAOCBG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|