C13H11N3O4 — CID 168543713
methyl 3-(2,2-dicyanoethenylamino)-4-hydroxy-5-methoxybenzoate (PubChem CID 168543713) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is methyl 3-(2,2-dicyanoethenylamino)-4-hydroxy-5-methoxybenzoate.
| Compound Name | methyl 3-(2,2-dicyanoethenylamino)-4-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 168543713 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | methyl 3-(2,2-dicyanoethenylamino)-4-hydroxy-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(NC=C(C#N)C#N)c(O)c(OC)c1 |
| InChI | InChI=1S/C13H11N3O4/c1-19-11-4-9(13(18)20-2)3-10(12(11)17)16-7-8(5-14)6-15/h3-4,7,16-17H,1-2H3 |
| InChIKey | KGJNZSOSFLKYAJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|