C16H17NO8 — CID 168539200
methyl 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxy-5-methoxybenzoate (PubChem CID 168539200) has the molecular formula C16H17NO8 and a molecular weight of 351.31 g/mol. Its IUPAC name is methyl 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxy-5-methoxybenzoate.
| Compound Name | methyl 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 168539200 |
| Molecular Formula | C16H17NO8 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | methyl 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-hydroxy-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(NC=C2C(=O)OC(C)(C)OC2=O)c(O)c(OC)c1 |
| InChI | InChI=1S/C16H17NO8/c1-16(2)24-14(20)9(15(21)25-16)7-17-10-5-8(13(19)23-4)6-11(22-3)12(10)18/h5-7,17-18H,1-4H3 |
| InChIKey | MPCWIJXVBWVYAD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|