C17H19NO8 — CID 168538101
methyl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxyphenoxy]acetate (PubChem CID 168538101) has the molecular formula C17H19NO8 and a molecular weight of 365.34 g/mol. Its IUPAC name is methyl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 168538101 |
| Molecular Formula | C17H19NO8 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | methyl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC=C2C(=O)OC(C)(C)OC2=O)cc1OC |
| InChI | InChI=1S/C17H19NO8/c1-17(2)25-15(20)11(16(21)26-17)8-18-10-5-6-12(13(7-10)22-3)24-9-14(19)23-4/h5-8,18H,9H2,1-4H3 |
| InChIKey | ORDMUBMUOQTNII-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|