C17H20N2O7 — CID 168537121
N-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxyphenyl]-2-methoxyacetamide (PubChem CID 168537121) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is N-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxyphenyl]-2-methoxyacetamide.
| Compound Name | N-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxyphenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 168537121 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxyphenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(NC=C2C(=O)OC(C)(C)OC2=O)cc1OC |
| InChI | InChI=1S/C17H20N2O7/c1-17(2)25-15(21)11(16(22)26-17)8-18-10-5-6-12(13(7-10)24-4)19-14(20)9-23-3/h5-8,18H,9H2,1-4H3,(H,19,20) |
| InChIKey | OHOXALOKTCLESN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|