C16H17ClN2O6 — CID 168537430
N-[4-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-2-methoxyacetamide (PubChem CID 168537430) has the molecular formula C16H17ClN2O6 and a molecular weight of 368.77 g/mol. Its IUPAC name is N-[4-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-2-methoxyacetamide.
| Compound Name | N-[4-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 168537430 |
| Molecular Formula | C16H17ClN2O6 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[4-chloro-3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(Cl)c(NC=C2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C16H17ClN2O6/c1-16(2)24-14(21)10(15(22)25-16)7-18-12-6-9(4-5-11(12)17)19-13(20)8-23-3/h4-7,18H,8H2,1-3H3,(H,19,20) |
| InChIKey | YNGUWUBXGNIABA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|